About 1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide
1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide (PubChem CID 175101882) has the molecular formula C14H19F3N2O
and a molecular weight of 288.31 g/mol. Its IUPAC name is 1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide.
Molecular Properties
| Compound Name | 1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide |
| PubChem CID | 175101882 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide |
| SMILES | CC1CC(c2ccc(C(F)(F)F)cc2)CN1C.NC=O |
| InChI | InChI=1S/C13H16F3N.CH3NO/c1-9-7-11(8-17(9)2)10-3-5-12(6-4-10)13(14,15)16;2-1-3/h3-6,9,11H,7-8H2,1-2H3;1H,(H2,2,3) |
| InChIKey | NBBWMPFWUPJRQY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide?
The IUPAC name of 1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide (CID 175101882) is 1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide.
What is the SMILES notation for 1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide?
The canonical SMILES for 1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide is CC1CC(c2ccc(C(F)(F)F)cc2)CN1C.NC=O.
What is the InChIKey of 1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide?
The InChIKey is NBBWMPFWUPJRQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3N.CH3NO/c1-9-7-11(8-17(9)2)10-3-5-12(6-4-10)13(14,15)16;2-1-3/h3-6,9,11H,7-8H2,1-2H3;1H,(H2,2,3).
What are the key properties of 1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide?
1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide has a molecular weight of 288.31 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine;formamide is sourced from PubChem (CID 175101882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).