C35H66O5Si — CID 175101968
[(2R,3R,4R,5R)-3,4,5-tris(dec-9-enoxy)oxolan-2-yl]methoxysilane (PubChem CID 175101968) has the molecular formula C35H66O5Si and a molecular weight of 594.99 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4,5-tris(dec-9-enoxy)oxolan-2-yl]methoxysilane.
| Compound Name | [(2R,3R,4R,5R)-3,4,5-tris(dec-9-enoxy)oxolan-2-yl]methoxysilane |
|---|---|
| PubChem CID | 175101968 |
| Molecular Formula | C35H66O5Si |
| Molecular Weight | 594.99 g/mol |
| Exact Mass | 594.47 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4,5-tris(dec-9-enoxy)oxolan-2-yl]methoxysilane |
| SMILES | C=CCCCCCCCCO[C@@H]1O[C@H](CO[SiH3])[C@@H](OCCCCCCCCC=C)[C@H]1OCCCCCCCCC=C |
| InChI | InChI=1S/C35H66O5Si/c1-4-7-10-13-16-19-22-25-28-36-33-32(31-39-41)40-35(38-30-27-24-21-18-15-12-9-6-3)34(33)37-29-26-23-20-17-14-11-8-5-2/h4-6,32-35H,1-3,7-31H2,41H3/t32-,33-,34-,35-/m1/s1 |
| InChIKey | PVFCKEDXAYIVSC-BAQBVXSRSA-N |
| XLogP | 8.55 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.99 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|