About cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide
cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide (PubChem CID 175101977) has the molecular formula C16H22N2O3
and a molecular weight of 290.36 g/mol. Its IUPAC name is cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide.
Molecular Properties
| Compound Name | cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide |
| PubChem CID | 175101977 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide |
| SMILES | CCOC(=O)C(=O)[NH+]=[N-].c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C12H16.C4H6N2O3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-9-4(8)3(7)6-5/h1,3-4,7-8,12H,2,5-6,9-10H2;6H,2H2,1H3 |
| InChIKey | JAEKNJBWNBAHMZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 79.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide?
The IUPAC name of cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide (CID 175101977) is cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide.
What is the SMILES notation for cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide?
The canonical SMILES for cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide is CCOC(=O)C(=O)[NH+]=[N-].c1ccc(C2CCCCC2)cc1.
What is the InChIKey of cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide?
The InChIKey is JAEKNJBWNBAHMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C4H6N2O3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-9-4(8)3(7)6-5/h1,3-4,7-8,12H,2,5-6,9-10H2;6H,2H2,1H3.
What are the key properties of cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide?
cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide has a molecular weight of 290.36 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylbenzene;(2-ethoxy-2-oxoacetyl)azaniumylideneazanide is sourced from PubChem (CID 175101977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).