About 4-(oxiran-2-yl)butan-1-ol;trimethoxysilane
4-(oxiran-2-yl)butan-1-ol;trimethoxysilane (PubChem CID 175102290) has the molecular formula C9H22O5Si
and a molecular weight of 238.36 g/mol. Its IUPAC name is 4-(oxiran-2-yl)butan-1-ol;trimethoxysilane.
Molecular Properties
| Compound Name | 4-(oxiran-2-yl)butan-1-ol;trimethoxysilane |
| PubChem CID | 175102290 |
| Molecular Formula | C9H22O5Si |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-(oxiran-2-yl)butan-1-ol;trimethoxysilane |
| SMILES | CO[SiH](OC)OC.OCCCCC1CO1 |
| InChI | InChI=1S/C6H12O2.C3H10O3Si/c7-4-2-1-3-6-5-8-6;1-4-7(5-2)6-3/h6-7H,1-5H2;7H,1-3H3 |
| InChIKey | LUONMDMOAZVWOX-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(oxiran-2-yl)butan-1-ol;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxiran-2-yl)butan-1-ol;trimethoxysilane?
The IUPAC name of 4-(oxiran-2-yl)butan-1-ol;trimethoxysilane (CID 175102290) is 4-(oxiran-2-yl)butan-1-ol;trimethoxysilane.
What is the SMILES notation for 4-(oxiran-2-yl)butan-1-ol;trimethoxysilane?
The canonical SMILES for 4-(oxiran-2-yl)butan-1-ol;trimethoxysilane is CO[SiH](OC)OC.OCCCCC1CO1.
What is the InChIKey of 4-(oxiran-2-yl)butan-1-ol;trimethoxysilane?
The InChIKey is LUONMDMOAZVWOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C3H10O3Si/c7-4-2-1-3-6-5-8-6;1-4-7(5-2)6-3/h6-7H,1-5H2;7H,1-3H3.
What are the key properties of 4-(oxiran-2-yl)butan-1-ol;trimethoxysilane?
4-(oxiran-2-yl)butan-1-ol;trimethoxysilane has a molecular weight of 238.36 g/mol, XLogP of 0.19, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxiran-2-yl)butan-1-ol;trimethoxysilane is sourced from PubChem (CID 175102290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).