C21H32N2O2 — CID 175102402
[5-[(4R,5S)-4-(hydroxymethyl)-1,1-dimethyl-2,3,4,5,6,7-hexahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol (PubChem CID 175102402) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is [5-[(4R,5S)-4-(hydroxymethyl)-1,1-dimethyl-2,3,4,5,6,7-hexahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol.
| Compound Name | [5-[(4R,5S)-4-(hydroxymethyl)-1,1-dimethyl-2,3,4,5,6,7-hexahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
|---|---|
| PubChem CID | 175102402 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | [5-[(4R,5S)-4-(hydroxymethyl)-1,1-dimethyl-2,3,4,5,6,7-hexahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
| SMILES | CC1(C)CCC2=C1CC[C@H](C1(C)Cc3cn[nH]c3CC1CO)[C@H]2CO |
| InChI | InChI=1S/C21H32N2O2/c1-20(2)7-6-15-16(12-25)18(5-4-17(15)20)21(3)9-13-10-22-23-19(13)8-14(21)11-24/h10,14,16,18,24-25H,4-9,11-12H2,1-3H3,(H,22,23)/t14?,16-,18-,21?/m0/s1 |
| InChIKey | YTLLJEXKIOLNHI-JOHJAULCSA-N |
| XLogP | 3.26 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|