About butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid
butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid (PubChem CID 175102689) has the molecular formula C9H17F3N2O6S2
and a molecular weight of 370.37 g/mol. Its IUPAC name is butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid |
| PubChem CID | 175102689 |
| Molecular Formula | C9H17F3N2O6S2 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid |
| SMILES | CCCCS(=O)(=O)O.Cc1ncc[nH]1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C4H6N2.C4H10O3S.CHF3O3S/c1-4-5-2-3-6-4;1-2-3-4-8(5,6)7;2-1(3,4)8(5,6)7/h2-3H,1H3,(H,5,6);2-4H2,1H3,(H,5,6,7);(H,5,6,7) |
| InChIKey | TYCVNZFOGNQYLT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 137.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid?
The IUPAC name of butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid (CID 175102689) is butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid.
What is the SMILES notation for butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid?
The canonical SMILES for butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid is CCCCS(=O)(=O)O.Cc1ncc[nH]1.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid?
The InChIKey is TYCVNZFOGNQYLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2.C4H10O3S.CHF3O3S/c1-4-5-2-3-6-4;1-2-3-4-8(5,6)7;2-1(3,4)8(5,6)7/h2-3H,1H3,(H,5,6);2-4H2,1H3,(H,5,6,7);(H,5,6,7).
What are the key properties of butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid?
butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid has a molecular weight of 370.37 g/mol, XLogP of 1.79, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1-sulfonic acid;2-methyl-1H-imidazole;trifluoromethanesulfonic acid is sourced from PubChem (CID 175102689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).