About azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate
azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate (PubChem CID 175102721) has the molecular formula C11H13F3N2O4S
and a molecular weight of 326.30 g/mol. Its IUPAC name is azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate.
Molecular Properties
| Compound Name | azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate |
| PubChem CID | 175102721 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate |
| SMILES | Cc1cc(CS(=O)(=O)OC2CNC2)ncc1OC(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O4S/c1-7-2-8(16-5-10(7)19-11(12,13)14)6-21(17,18)20-9-3-15-4-9/h2,5,9,15H,3-4,6H2,1H3 |
| InChIKey | OPIHXGWENBFAIT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate?
The IUPAC name of azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate (CID 175102721) is azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate.
What is the SMILES notation for azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate?
The canonical SMILES for azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate is Cc1cc(CS(=O)(=O)OC2CNC2)ncc1OC(F)(F)F.
What is the InChIKey of azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate?
The InChIKey is OPIHXGWENBFAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3N2O4S/c1-7-2-8(16-5-10(7)19-11(12,13)14)6-21(17,18)20-9-3-15-4-9/h2,5,9,15H,3-4,6H2,1H3.
What are the key properties of azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate?
azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate has a molecular weight of 326.30 g/mol, XLogP of 1.11, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-3-yl [4-methyl-5-(trifluoromethoxy)-2-pyridinyl]methanesulfonate is sourced from PubChem (CID 175102721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).