About 2-oxoethane-1,1-disulfinate
2-oxoethane-1,1-disulfinate (PubChem CID 175102813) has the molecular formula C2H2O5S2-2
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-oxoethane-1,1-disulfinate.
Molecular Properties
| Compound Name | 2-oxoethane-1,1-disulfinate |
| PubChem CID | 175102813 |
| Molecular Formula | C2H2O5S2-2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 169.94 |
| IUPAC Name | 2-oxoethane-1,1-disulfinate |
| SMILES | O=CC(S(=O)[O-])S(=O)[O-] |
| InChI | InChI=1S/C2H4O5S2/c3-1-2(8(4)5)9(6)7/h1-2H,(H,4,5)(H,6,7)/p-2 |
| InChIKey | SNUAIQIVVOBTNL-UHFFFAOYSA-L |
| XLogP | -1.73 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-oxoethane-1,1-disulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoethane-1,1-disulfinate?
The IUPAC name of 2-oxoethane-1,1-disulfinate (CID 175102813) is 2-oxoethane-1,1-disulfinate.
What is the SMILES notation for 2-oxoethane-1,1-disulfinate?
The canonical SMILES for 2-oxoethane-1,1-disulfinate is O=CC(S(=O)[O-])S(=O)[O-].
What is the InChIKey of 2-oxoethane-1,1-disulfinate?
The InChIKey is SNUAIQIVVOBTNL-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O5S2/c3-1-2(8(4)5)9(6)7/h1-2H,(H,4,5)(H,6,7)/p-2.
What are the key properties of 2-oxoethane-1,1-disulfinate?
2-oxoethane-1,1-disulfinate has a molecular weight of 170.17 g/mol, XLogP of -1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoethane-1,1-disulfinate is sourced from PubChem (CID 175102813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).