C15H9F17S — CID 175102867
(4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-λ6-sulfane (PubChem CID 175102867) has the molecular formula C15H9F17S and a molecular weight of 544.27 g/mol. Its IUPAC name is (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-λ6-sulfane.
| Compound Name | (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-λ6-sulfane |
|---|---|
| PubChem CID | 175102867 |
| Molecular Formula | C15H9F17S |
| Molecular Weight | 544.27 g/mol |
| Exact Mass | 544.02 |
| IUPAC Name | (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-λ6-sulfane |
| SMILES | C=CC1=CCC(=CS(F)(F)(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C=C1 |
| InChI | InChI=1S/C15H9F17S/c1-2-8-3-5-9(6-4-8)7-33(29,30,31,32)15(27,28)13(22,23)11(18,19)10(16,17)12(20,21)14(24,25)26/h2-5,7H,1,6H2 |
| InChIKey | OKGPKPLXKBZLGB-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.27 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|