C11H10F3N3 — CID 175103195
N-methyl-1-[(2,3,4-trifluorophenyl)methyl]pyrazol-4-amine (PubChem CID 175103195) has the molecular formula C11H10F3N3 and a molecular weight of 241.22 g/mol. Its IUPAC name is N-methyl-1-[(2,3,4-trifluorophenyl)methyl]pyrazol-4-amine.
| Compound Name | N-methyl-1-[(2,3,4-trifluorophenyl)methyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 175103195 |
| Molecular Formula | C11H10F3N3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | N-methyl-1-[(2,3,4-trifluorophenyl)methyl]pyrazol-4-amine |
| SMILES | CNc1cnn(Cc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C11H10F3N3/c1-15-8-4-16-17(6-8)5-7-2-3-9(12)11(14)10(7)13/h2-4,6,15H,5H2,1H3 |
| InChIKey | CFUZDWHTPITPSK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|