C4Br3Cl2F5 — CID 175103330
1,3,4-tribromo-1,2-dichloro-1,2,3,4,4-pentafluorobutane (PubChem CID 175103330) has the molecular formula C4Br3Cl2F5 and a molecular weight of 453.65 g/mol. Its IUPAC name is 1,3,4-tribromo-1,2-dichloro-1,2,3,4,4-pentafluorobutane.
| Compound Name | 1,3,4-tribromo-1,2-dichloro-1,2,3,4,4-pentafluorobutane |
|---|---|
| PubChem CID | 175103330 |
| Molecular Formula | C4Br3Cl2F5 |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 449.68 |
| IUPAC Name | 1,3,4-tribromo-1,2-dichloro-1,2,3,4,4-pentafluorobutane |
| SMILES | FC(F)(Br)C(F)(Br)C(F)(Cl)C(F)(Cl)Br |
| InChI | InChI=1S/C4Br3Cl2F5/c5-1(10,4(7,13)14)2(8,11)3(6,9)12 |
| InChIKey | MJYLHTAKDJEWHX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|