C22H37NO2 — CID 175104579
formamide;1,1,2,2-tetramethyl-4,5,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 175104579) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is formamide;1,1,2,2-tetramethyl-4,5,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | formamide;1,1,2,2-tetramethyl-4,5,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 175104579 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | formamide;1,1,2,2-tetramethyl-4,5,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1(C)C(=O)CC2CCC3C4CCCC4CCC3C2C1(C)C.NC=O |
| InChI | InChI=1S/C21H34O.CH3NO/c1-20(2)18(22)12-14-9-10-16-15-7-5-6-13(15)8-11-17(16)19(14)21(20,3)4;2-1-3/h13-17,19H,5-12H2,1-4H3;1H,(H2,2,3) |
| InChIKey | XHAZLCRLOQXTOO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|