About 2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron
2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron (PubChem CID 175105040) has the molecular formula C19H27FeN-6
and a molecular weight of 325.28 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron.
Molecular Properties
| Compound Name | 2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron |
| PubChem CID | 175105040 |
| Molecular Formula | C19H27FeN-6 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron |
| SMILES | C=C(CN(C(C)C)C(C)C)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C14H22N.C5H5.Fe/c1-11(2)15(12(3)4)10-13(5)14-8-6-7-9-14;1-2-4-5-3-1;/h6-9,11-12H,5,10H2,1-4H3;1-5H;/q-1;-5; |
| InChIKey | SRLOTXZYNZYCKG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron?
The IUPAC name of 2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron (CID 175105040) is 2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron.
What is the SMILES notation for 2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron?
The canonical SMILES for 2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron is C=C(CN(C(C)C)C(C)C)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of 2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron?
The InChIKey is SRLOTXZYNZYCKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N.C5H5.Fe/c1-11(2)15(12(3)4)10-13(5)14-8-6-7-9-14;1-2-4-5-3-1;/h6-9,11-12H,5,10H2,1-4H3;1-5H;/q-1;-5;.
What are the key properties of 2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron?
2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron has a molecular weight of 325.28 g/mol, XLogP of 4.94, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-2,4-dien-1-yl-N,N-di(propan-2-yl)prop-2-en-1-amine;cyclopentane;iron is sourced from PubChem (CID 175105040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).