About [2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane
[2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane (PubChem CID 175105513) has the molecular formula C8H13F3OSi
and a molecular weight of 210.27 g/mol. Its IUPAC name is [2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane.
Molecular Properties
| Compound Name | [2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane |
| PubChem CID | 175105513 |
| Molecular Formula | C8H13F3OSi |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | [2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane |
| SMILES | FC(F)(F)C=CC1([SiH3])CCCCO1 |
| InChI | InChI=1S/C8H13F3OSi/c9-8(10,11)5-4-7(13)3-1-2-6-12-7/h4-5H,1-3,6H2,13H3 |
| InChIKey | OOYNQQIQASKCHG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane?
The IUPAC name of [2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane (CID 175105513) is [2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane.
What is the SMILES notation for [2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane?
The canonical SMILES for [2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane is FC(F)(F)C=CC1([SiH3])CCCCO1.
What is the InChIKey of [2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane?
The InChIKey is OOYNQQIQASKCHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3OSi/c9-8(10,11)5-4-7(13)3-1-2-6-12-7/h4-5H,1-3,6H2,13H3.
What are the key properties of [2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane?
[2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane has a molecular weight of 210.27 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,3,3-trifluoroprop-1-enyl)oxan-2-yl]silane is sourced from PubChem (CID 175105513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).