About sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate
sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate (PubChem CID 175105872) has the molecular formula C3H4F3NaO4S
and a molecular weight of 216.11 g/mol. Its IUPAC name is sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate |
| PubChem CID | 175105872 |
| Molecular Formula | C3H4F3NaO4S |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate |
| SMILES | CS(=O)(=O)OC(=O)C(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C3H3F3O4S.Na.H/c1-11(8,9)10-2(7)3(4,5)6;;/h1H3;;/q;+1;-1 |
| InChIKey | BTXLKWVLWMBEMU-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate?
The IUPAC name of sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate (CID 175105872) is sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate.
What is the SMILES notation for sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate?
The canonical SMILES for sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate is CS(=O)(=O)OC(=O)C(F)(F)F.[H-].[Na+].
What is the InChIKey of sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate?
The InChIKey is BTXLKWVLWMBEMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3F3O4S.Na.H/c1-11(8,9)10-2(7)3(4,5)6;;/h1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate?
sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate has a molecular weight of 216.11 g/mol, XLogP of -2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;methylsulfonyl 2,2,2-trifluoroacetate is sourced from PubChem (CID 175105872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).