About 3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid
3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid (PubChem CID 175106026) has the molecular formula C15H18O5
and a molecular weight of 278.30 g/mol. Its IUPAC name is 3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid.
Molecular Properties
| Compound Name | 3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid |
| PubChem CID | 175106026 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid |
| SMILES | CC(C)CC(=O)CC(=O)O.O=C1OCc2ccccc21 |
| InChI | InChI=1S/C8H6O2.C7H12O3/c9-8-7-4-2-1-3-6(7)5-10-8;1-5(2)3-6(8)4-7(9)10/h1-4H,5H2;5H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | TZNDTLAEMMKIRD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid?
The IUPAC name of 3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid (CID 175106026) is 3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid.
What is the SMILES notation for 3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid?
The canonical SMILES for 3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid is CC(C)CC(=O)CC(=O)O.O=C1OCc2ccccc21.
What is the InChIKey of 3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid?
The InChIKey is TZNDTLAEMMKIRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2.C7H12O3/c9-8-7-4-2-1-3-6(7)5-10-8;1-5(2)3-6(8)4-7(9)10/h1-4H,5H2;5H,3-4H2,1-2H3,(H,9,10).
What are the key properties of 3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid?
3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid has a molecular weight of 278.30 g/mol, XLogP of 2.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-2-benzofuran-1-one;5-methyl-3-oxohexanoic acid is sourced from PubChem (CID 175106026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).