About 2,3,4,5-tetramethylpyridine;hydrate
2,3,4,5-tetramethylpyridine;hydrate (PubChem CID 175106370) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 2,3,4,5-tetramethylpyridine;hydrate.
Molecular Properties
| Compound Name | 2,3,4,5-tetramethylpyridine;hydrate |
| PubChem CID | 175106370 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2,3,4,5-tetramethylpyridine;hydrate |
| SMILES | Cc1cnc(C)c(C)c1C.O |
| InChI | InChI=1S/C9H13N.H2O/c1-6-5-10-9(4)8(3)7(6)2;/h5H,1-4H3;1H2 |
| InChIKey | GKUVYQIXUDSZHM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 44.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,4,5-tetramethylpyridine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetramethylpyridine;hydrate?
The IUPAC name of 2,3,4,5-tetramethylpyridine;hydrate (CID 175106370) is 2,3,4,5-tetramethylpyridine;hydrate.
What is the SMILES notation for 2,3,4,5-tetramethylpyridine;hydrate?
The canonical SMILES for 2,3,4,5-tetramethylpyridine;hydrate is Cc1cnc(C)c(C)c1C.O.
What is the InChIKey of 2,3,4,5-tetramethylpyridine;hydrate?
The InChIKey is GKUVYQIXUDSZHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.H2O/c1-6-5-10-9(4)8(3)7(6)2;/h5H,1-4H3;1H2.
What are the key properties of 2,3,4,5-tetramethylpyridine;hydrate?
2,3,4,5-tetramethylpyridine;hydrate has a molecular weight of 153.22 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetramethylpyridine;hydrate is sourced from PubChem (CID 175106370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).