About (3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate
(3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate (PubChem CID 175106762) has the molecular formula C21H26N4O2
and a molecular weight of 366.46 g/mol. Its IUPAC name is (3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | (3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate |
| PubChem CID | 175106762 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(C(=O)Oc1cccc(-c2cncnc2)c1)C1CN2CCC1CC2 |
| InChI | InChI=1S/C21H26N4O2/c1-15(2)25(20-13-24-8-6-16(20)7-9-24)21(26)27-19-5-3-4-17(10-19)18-11-22-14-23-12-18/h3-5,10-12,14-16,20H,6-9,13H2,1-2H3 |
| InChIKey | WCWPDCOZKFDFSG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate?
The IUPAC name of (3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate (CID 175106762) is (3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate.
What is the SMILES notation for (3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate?
The canonical SMILES for (3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate is CC(C)N(C(=O)Oc1cccc(-c2cncnc2)c1)C1CN2CCC1CC2.
What is the InChIKey of (3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate?
The InChIKey is WCWPDCOZKFDFSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O2/c1-15(2)25(20-13-24-8-6-16(20)7-9-24)21(26)27-19-5-3-4-17(10-19)18-11-22-14-23-12-18/h3-5,10-12,14-16,20H,6-9,13H2,1-2H3.
What are the key properties of (3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate?
(3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate has a molecular weight of 366.46 g/mol, XLogP of 3.45, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-pyrimidin-5-ylphenyl) N-(1-azabicyclo[2.2.2]octan-3-yl)-N-propan-2-ylcarbamate is sourced from PubChem (CID 175106762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).