About methanol;oxane-2,6-dione
methanol;oxane-2,6-dione (PubChem CID 175106856) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is methanol;oxane-2,6-dione.
Molecular Properties
| Compound Name | methanol;oxane-2,6-dione |
| PubChem CID | 175106856 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | methanol;oxane-2,6-dione |
| SMILES | CO.O=C1CCCC(=O)O1 |
| InChI | InChI=1S/C5H6O3.CH4O/c6-4-2-1-3-5(7)8-4;1-2/h1-3H2;2H,1H3 |
| InChIKey | BXNWRBFCWQBYMX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methanol;oxane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;oxane-2,6-dione?
The IUPAC name of methanol;oxane-2,6-dione (CID 175106856) is methanol;oxane-2,6-dione.
What is the SMILES notation for methanol;oxane-2,6-dione?
The canonical SMILES for methanol;oxane-2,6-dione is CO.O=C1CCCC(=O)O1.
What is the InChIKey of methanol;oxane-2,6-dione?
The InChIKey is BXNWRBFCWQBYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3.CH4O/c6-4-2-1-3-5(7)8-4;1-2/h1-3H2;2H,1H3.
What are the key properties of methanol;oxane-2,6-dione?
methanol;oxane-2,6-dione has a molecular weight of 146.14 g/mol, XLogP of -0.15, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;oxane-2,6-dione is sourced from PubChem (CID 175106856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).