About cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese
cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese (PubChem CID 175107050) has the molecular formula C14H18Mn-6
and a molecular weight of 241.24 g/mol. Its IUPAC name is cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese.
Molecular Properties
| Compound Name | cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese |
| PubChem CID | 175107050 |
| Molecular Formula | C14H18Mn-6 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese |
| SMILES | CCc1ccc[c-]1CC.[Mn].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C9H13.C5H5.Mn/c1-3-8-6-5-7-9(8)4-2;1-2-4-5-3-1;/h5-7H,3-4H2,1-2H3;1-5H;/q-1;-5; |
| InChIKey | XRCRWYXOMDZWHU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese?
The IUPAC name of cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese (CID 175107050) is cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese.
What is the SMILES notation for cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese?
The canonical SMILES for cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese is CCc1ccc[c-]1CC.[Mn].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese?
The InChIKey is XRCRWYXOMDZWHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13.C5H5.Mn/c1-3-8-6-5-7-9(8)4-2;1-2-4-5-3-1;/h5-7H,3-4H2,1-2H3;1-5H;/q-1;-5;.
What are the key properties of cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese?
cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese has a molecular weight of 241.24 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;1,5-diethylcyclopenta-1,3-diene;manganese is sourced from PubChem (CID 175107050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).