C34H37F2N3O3 — CID 175107487
3-[[1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]-(4-methylbenzoyl)amino]propylcarbamic acid (PubChem CID 175107487) has the molecular formula C34H37F2N3O3 and a molecular weight of 573.68 g/mol. Its IUPAC name is 3-[[1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]-(4-methylbenzoyl)amino]propylcarbamic acid.
| Compound Name | 3-[[1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]-(4-methylbenzoyl)amino]propylcarbamic acid |
|---|---|
| PubChem CID | 175107487 |
| Molecular Formula | C34H37F2N3O3 |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | 3-[[1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]-(4-methylbenzoyl)amino]propylcarbamic acid |
| SMILES | Cc1ccc(C(=O)N(CCCNC(=O)O)C(c2cc(-c3cc(F)ccc3F)cn2Cc2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C34H37F2N3O3/c1-23-11-13-25(14-12-23)32(40)39(18-8-17-37-33(41)42)31(34(2,3)4)30-19-26(28-20-27(35)15-16-29(28)36)22-38(30)21-24-9-6-5-7-10-24/h5-7,9-16,19-20,22,31,37H,8,17-18,21H2,1-4H3,(H,41,42) |
| InChIKey | VJOXMHMEXOPZRE-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|