About 2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline
2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline (PubChem CID 175107774) has the molecular formula C16H33NO6
and a molecular weight of 335.44 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline.
Molecular Properties
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline |
| PubChem CID | 175107774 |
| Molecular Formula | C16H33NO6 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline |
| SMILES | CCO.CCO.Cc1ccc(N)cc1.OCC(CO)(CO)CO |
| InChI | InChI=1S/C7H9N.C5H12O4.2C2H6O/c1-6-2-4-7(8)5-3-6;6-1-5(2-7,3-8)4-9;2*1-2-3/h2-5H,8H2,1H3;6-9H,1-4H2;2*3H,2H2,1H3 |
| InChIKey | FHDRVSSXTXKVAD-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline?
The IUPAC name of 2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline (CID 175107774) is 2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline.
What is the SMILES notation for 2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline?
The canonical SMILES for 2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline is CCO.CCO.Cc1ccc(N)cc1.OCC(CO)(CO)CO.
What is the InChIKey of 2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline?
The InChIKey is FHDRVSSXTXKVAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C5H12O4.2C2H6O/c1-6-2-4-7(8)5-3-6;6-1-5(2-7,3-8)4-9;2*1-2-3/h2-5H,8H2,1H3;6-9H,1-4H2;2*3H,2H2,1H3.
What are the key properties of 2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline?
2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline has a molecular weight of 335.44 g/mol, XLogP of -0.48, 4 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(hydroxymethyl)propane-1,3-diol;ethanol;4-methylaniline is sourced from PubChem (CID 175107774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).