C13H9F3N4O4 — CID 175108225
1-[3-(N'-carboxycarbamimidoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxylic acid (PubChem CID 175108225) has the molecular formula C13H9F3N4O4 and a molecular weight of 342.23 g/mol. Its IUPAC name is 1-[3-(N'-carboxycarbamimidoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxylic acid.
| Compound Name | 1-[3-(N'-carboxycarbamimidoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 175108225 |
| Molecular Formula | C13H9F3N4O4 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 1-[3-(N'-carboxycarbamimidoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxylic acid |
| SMILES | NC(=NC(=O)O)c1cccc(-n2nc(C(F)(F)F)cc2C(=O)O)c1 |
| InChI | InChI=1S/C13H9F3N4O4/c14-13(15,16)9-5-8(11(21)22)20(19-9)7-3-1-2-6(4-7)10(17)18-12(23)24/h1-5H,(H2,17,18)(H,21,22)(H,23,24) |
| InChIKey | KKXDFGKSGYHYPA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|