About [(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate
[(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate (PubChem CID 175108729) has the molecular formula C17H19ClN4O2
and a molecular weight of 346.82 g/mol. Its IUPAC name is [(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate.
Molecular Properties
| Compound Name | [(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate |
| PubChem CID | 175108729 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate |
| SMILES | NC(=O)O[C@H]1CCC[C@@H](Nc2cc(-c3ccccc3)nc(Cl)n2)C1 |
| InChI | InChI=1S/C17H19ClN4O2/c18-16-21-14(11-5-2-1-3-6-11)10-15(22-16)20-12-7-4-8-13(9-12)24-17(19)23/h1-3,5-6,10,12-13H,4,7-9H2,(H2,19,23)(H,20,21,22)/t12-,13+/m1/s1 |
| InChIKey | CWVVUSYUXPMTCI-OLZOCXBDSA-N |
| XLogP | 3.62 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate?
The IUPAC name of [(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate (CID 175108729) is [(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate.
What is the SMILES notation for [(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate?
The canonical SMILES for [(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate is NC(=O)O[C@H]1CCC[C@@H](Nc2cc(-c3ccccc3)nc(Cl)n2)C1.
What is the InChIKey of [(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate?
The InChIKey is CWVVUSYUXPMTCI-OLZOCXBDSA-N. The full InChI is InChI=1S/C17H19ClN4O2/c18-16-21-14(11-5-2-1-3-6-11)10-15(22-16)20-12-7-4-8-13(9-12)24-17(19)23/h1-3,5-6,10,12-13H,4,7-9H2,(H2,19,23)(H,20,21,22)/t12-,13+/m1/s1.
What are the key properties of [(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate?
[(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate has a molecular weight of 346.82 g/mol, XLogP of 3.62, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3R)-3-[(2-chloro-6-phenylpyrimidin-4-yl)amino]cyclohexyl] carbamate is sourced from PubChem (CID 175108729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).