About 1,2-difluorophenanthridine
1,2-difluorophenanthridine (PubChem CID 175109006) has the molecular formula C13H7F2N
and a molecular weight of 215.20 g/mol. Its IUPAC name is 1,2-difluorophenanthridine.
Molecular Properties
| Compound Name | 1,2-difluorophenanthridine |
| PubChem CID | 175109006 |
| Molecular Formula | C13H7F2N |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 1,2-difluorophenanthridine |
| SMILES | Fc1ccc2ncc3ccccc3c2c1F |
| InChI | InChI=1S/C13H7F2N/c14-10-5-6-11-12(13(10)15)9-4-2-1-3-8(9)7-16-11/h1-7H |
| InChIKey | PANASNYEVMCYNZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,2-difluorophenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluorophenanthridine?
The IUPAC name of 1,2-difluorophenanthridine (CID 175109006) is 1,2-difluorophenanthridine.
What is the SMILES notation for 1,2-difluorophenanthridine?
The canonical SMILES for 1,2-difluorophenanthridine is Fc1ccc2ncc3ccccc3c2c1F.
What is the InChIKey of 1,2-difluorophenanthridine?
The InChIKey is PANASNYEVMCYNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F2N/c14-10-5-6-11-12(13(10)15)9-4-2-1-3-8(9)7-16-11/h1-7H.
What are the key properties of 1,2-difluorophenanthridine?
1,2-difluorophenanthridine has a molecular weight of 215.20 g/mol, XLogP of 3.67, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluorophenanthridine is sourced from PubChem (CID 175109006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).