About dimethyl(3-methylbuta-1,3-dien-2-yl)silane
dimethyl(3-methylbuta-1,3-dien-2-yl)silane (PubChem CID 175109066) has the molecular formula C7H14Si
and a molecular weight of 126.27 g/mol. Its IUPAC name is dimethyl(3-methylbuta-1,3-dien-2-yl)silane.
Molecular Properties
| Compound Name | dimethyl(3-methylbuta-1,3-dien-2-yl)silane |
| PubChem CID | 175109066 |
| Molecular Formula | C7H14Si |
| Molecular Weight | 126.27 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | dimethyl(3-methylbuta-1,3-dien-2-yl)silane |
| SMILES | C=C(C)C(=C)[SiH](C)C |
| InChI | InChI=1S/C7H14Si/c1-6(2)7(3)8(4)5/h8H,1,3H2,2,4-5H3 |
| InChIKey | ODNBXQWLWQLADL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(3-methylbuta-1,3-dien-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(3-methylbuta-1,3-dien-2-yl)silane?
The IUPAC name of dimethyl(3-methylbuta-1,3-dien-2-yl)silane (CID 175109066) is dimethyl(3-methylbuta-1,3-dien-2-yl)silane.
What is the SMILES notation for dimethyl(3-methylbuta-1,3-dien-2-yl)silane?
The canonical SMILES for dimethyl(3-methylbuta-1,3-dien-2-yl)silane is C=C(C)C(=C)[SiH](C)C.
What is the InChIKey of dimethyl(3-methylbuta-1,3-dien-2-yl)silane?
The InChIKey is ODNBXQWLWQLADL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14Si/c1-6(2)7(3)8(4)5/h8H,1,3H2,2,4-5H3.
What are the key properties of dimethyl(3-methylbuta-1,3-dien-2-yl)silane?
dimethyl(3-methylbuta-1,3-dien-2-yl)silane has a molecular weight of 126.27 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(3-methylbuta-1,3-dien-2-yl)silane is sourced from PubChem (CID 175109066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).