C21H32BNO5 — CID 175109247
[3-formyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] N-tert-butyl-N-propylcarbamate (PubChem CID 175109247) has the molecular formula C21H32BNO5 and a molecular weight of 389.30 g/mol. Its IUPAC name is [3-formyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] N-tert-butyl-N-propylcarbamate.
| Compound Name | [3-formyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] N-tert-butyl-N-propylcarbamate |
|---|---|
| PubChem CID | 175109247 |
| Molecular Formula | C21H32BNO5 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | [3-formyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] N-tert-butyl-N-propylcarbamate |
| SMILES | CCCN(C(=O)Oc1cccc(C=O)c1B1OC(C)(C)C(C)(C)O1)C(C)(C)C |
| InChI | InChI=1S/C21H32BNO5/c1-9-13-23(19(2,3)4)18(25)26-16-12-10-11-15(14-24)17(16)22-27-20(5,6)21(7,8)28-22/h10-12,14H,9,13H2,1-8H3 |
| InChIKey | BYILZDFCFZHEAD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|