C10H25BO5 — CID 175110139
boric acid;2,2-dimethyl-1-(2-propan-2-yloxyethoxy)propane (PubChem CID 175110139) has the molecular formula C10H25BO5 and a molecular weight of 236.12 g/mol. Its IUPAC name is boric acid;2,2-dimethyl-1-(2-propan-2-yloxyethoxy)propane.
| Compound Name | boric acid;2,2-dimethyl-1-(2-propan-2-yloxyethoxy)propane |
|---|---|
| PubChem CID | 175110139 |
| Molecular Formula | C10H25BO5 |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | boric acid;2,2-dimethyl-1-(2-propan-2-yloxyethoxy)propane |
| SMILES | CC(C)OCCOCC(C)(C)C.OB(O)O |
| InChI | InChI=1S/C10H22O2.BH3O3/c1-9(2)12-7-6-11-8-10(3,4)5;2-1(3)4/h9H,6-8H2,1-5H3;2-4H |
| InChIKey | IQCPWGHIJSCEBW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|