C8H5F9NO2P — CID 175110170
1-(1,1,2,2,3,3,4,4,4-nonafluorobutylphosphanyl)pyrrolidine-2,5-dione (PubChem CID 175110170) has the molecular formula C8H5F9NO2P and a molecular weight of 349.09 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,4-nonafluorobutylphosphanyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutylphosphanyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 175110170 |
| Molecular Formula | C8H5F9NO2P |
| Molecular Weight | 349.09 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutylphosphanyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1PC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F9NO2P/c9-5(10,7(13,14)15)6(11,12)8(16,17)21-18-3(19)1-2-4(18)20/h21H,1-2H2 |
| InChIKey | AKPMWCNJSNBZJV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.09 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|