About phenyl 3-methylundecanoate
phenyl 3-methylundecanoate (PubChem CID 175110466) has the molecular formula C18H28O2
and a molecular weight of 276.42 g/mol. Its IUPAC name is phenyl 3-methylundecanoate.
Molecular Properties
| Compound Name | phenyl 3-methylundecanoate |
| PubChem CID | 175110466 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | phenyl 3-methylundecanoate |
| SMILES | CCCCCCCCC(C)CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H28O2/c1-3-4-5-6-7-9-12-16(2)15-18(19)20-17-13-10-8-11-14-17/h8,10-11,13-14,16H,3-7,9,12,15H2,1-2H3 |
| InChIKey | CYZALHLQTMDHQH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 3-methylundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 3-methylundecanoate?
The IUPAC name of phenyl 3-methylundecanoate (CID 175110466) is phenyl 3-methylundecanoate.
What is the SMILES notation for phenyl 3-methylundecanoate?
The canonical SMILES for phenyl 3-methylundecanoate is CCCCCCCCC(C)CC(=O)Oc1ccccc1.
What is the InChIKey of phenyl 3-methylundecanoate?
The InChIKey is CYZALHLQTMDHQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-3-4-5-6-7-9-12-16(2)15-18(19)20-17-13-10-8-11-14-17/h8,10-11,13-14,16H,3-7,9,12,15H2,1-2H3.
What are the key properties of phenyl 3-methylundecanoate?
phenyl 3-methylundecanoate has a molecular weight of 276.42 g/mol, XLogP of 5.37, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 3-methylundecanoate is sourced from PubChem (CID 175110466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).