C26H37NO3 — CID 175111156
4-hydroxy-5-(3-methylbutylamino)-3-[[(1R,2S,4R)-1,2,4-trimethyl-5-methylidene-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methyl]cyclohexa-3,5-diene-1,2-dione (PubChem CID 175111156) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is 4-hydroxy-5-(3-methylbutylamino)-3-[[(1R,2S,4R)-1,2,4-trimethyl-5-methylidene-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methyl]cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-hydroxy-5-(3-methylbutylamino)-3-[[(1R,2S,4R)-1,2,4-trimethyl-5-methylidene-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methyl]cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 175111156 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 4-hydroxy-5-(3-methylbutylamino)-3-[[(1R,2S,4R)-1,2,4-trimethyl-5-methylidene-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methyl]cyclohexa-3,5-diene-1,2-dione |
| SMILES | C=C1CCCC2=C1[C@H](C)C[C@H](C)[C@@]2(C)CC1=C(O)C(NCCC(C)C)=CC(=O)C1=O |
| InChI | InChI=1S/C26H37NO3/c1-15(2)10-11-27-21-13-22(28)25(30)19(24(21)29)14-26(6)18(5)12-17(4)23-16(3)8-7-9-20(23)26/h13,15,17-18,27,29H,3,7-12,14H2,1-2,4-6H3/t17-,18+,26-/m1/s1 |
| InChIKey | KLWAJGMNIHNLLS-FIAZIHOUSA-N |
| XLogP | 5.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|