About [6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate
[6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate (PubChem CID 175111264) has the molecular formula C22H28N6O3
and a molecular weight of 424.51 g/mol. Its IUPAC name is [6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate.
Molecular Properties
| Compound Name | [6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate |
| PubChem CID | 175111264 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | [6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate |
| SMILES | CCCCOc1nc(OC(N)=O)c2cnn(Cc3ccc(CN4CCCC4)cc3)c2n1 |
| InChI | InChI=1S/C22H28N6O3/c1-2-3-12-30-22-25-19-18(20(26-22)31-21(23)29)13-24-28(19)15-17-8-6-16(7-9-17)14-27-10-4-5-11-27/h6-9,13H,2-5,10-12,14-15H2,1H3,(H2,23,29) |
| InChIKey | GVWQVUHGWLMHKA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate?
The IUPAC name of [6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate (CID 175111264) is [6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate.
What is the SMILES notation for [6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate?
The canonical SMILES for [6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate is CCCCOc1nc(OC(N)=O)c2cnn(Cc3ccc(CN4CCCC4)cc3)c2n1.
What is the InChIKey of [6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate?
The InChIKey is GVWQVUHGWLMHKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N6O3/c1-2-3-12-30-22-25-19-18(20(26-22)31-21(23)29)13-24-28(19)15-17-8-6-16(7-9-17)14-27-10-4-5-11-27/h6-9,13H,2-5,10-12,14-15H2,1H3,(H2,23,29).
What are the key properties of [6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate?
[6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate has a molecular weight of 424.51 g/mol, XLogP of 3.11, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[5,4-d]pyrimidin-4-yl] carbamate is sourced from PubChem (CID 175111264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).