C14H17F9O3 — CID 175112052
1-hydroxyethyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-methylidene-3-(2-methylpropyl)heptanoate (PubChem CID 175112052) has the molecular formula C14H17F9O3 and a molecular weight of 404.27 g/mol. Its IUPAC name is 1-hydroxyethyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-methylidene-3-(2-methylpropyl)heptanoate.
| Compound Name | 1-hydroxyethyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-methylidene-3-(2-methylpropyl)heptanoate |
|---|---|
| PubChem CID | 175112052 |
| Molecular Formula | C14H17F9O3 |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 1-hydroxyethyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-methylidene-3-(2-methylpropyl)heptanoate |
| SMILES | C=C(C(=O)OC(C)O)C(CC(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H17F9O3/c1-6(2)5-9(7(3)10(25)26-8(4)24)11(15,16)12(17,18)13(19,20)14(21,22)23/h6,8-9,24H,3,5H2,1-2,4H3 |
| InChIKey | FRRXYJICXRISNT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|