C25H29N5O2S — CID 175112061
6-[(2,2-dimethylpiperidin-1-yl)methyl]-8-methyl-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one;formamide (PubChem CID 175112061) has the molecular formula C25H29N5O2S and a molecular weight of 463.61 g/mol. Its IUPAC name is 6-[(2,2-dimethylpiperidin-1-yl)methyl]-8-methyl-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one;formamide.
| Compound Name | 6-[(2,2-dimethylpiperidin-1-yl)methyl]-8-methyl-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one;formamide |
|---|---|
| PubChem CID | 175112061 |
| Molecular Formula | C25H29N5O2S |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 6-[(2,2-dimethylpiperidin-1-yl)methyl]-8-methyl-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one;formamide |
| SMILES | Cc1cc(CN2CCCCC2(C)C)cc2c(=O)[nH]c(-c3cc4sccc4cn3)nc12.NC=O |
| InChI | InChI=1S/C24H26N4OS.CH3NO/c1-15-10-16(14-28-8-5-4-7-24(28,2)3)11-18-21(15)26-22(27-23(18)29)19-12-20-17(13-25-19)6-9-30-20;2-1-3/h6,9-13H,4-5,7-8,14H2,1-3H3,(H,26,27,29);1H,(H2,2,3) |
| InChIKey | VKWPASSFFQYWRH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|