About cyclopropene;phenylboronic acid
cyclopropene;phenylboronic acid (PubChem CID 175112144) has the molecular formula C9H11BO2
and a molecular weight of 162.00 g/mol. Its IUPAC name is cyclopropene;phenylboronic acid.
Molecular Properties
| Compound Name | cyclopropene;phenylboronic acid |
| PubChem CID | 175112144 |
| Molecular Formula | C9H11BO2 |
| Molecular Weight | 162.00 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | cyclopropene;phenylboronic acid |
| SMILES | C1=CC1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C6H7BO2.C3H4/c8-7(9)6-4-2-1-3-5-6;1-2-3-1/h1-5,8-9H;1-2H,3H2 |
| InChIKey | OKZILKUTUVWOQE-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.00 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopropene;phenylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropene;phenylboronic acid?
The IUPAC name of cyclopropene;phenylboronic acid (CID 175112144) is cyclopropene;phenylboronic acid.
What is the SMILES notation for cyclopropene;phenylboronic acid?
The canonical SMILES for cyclopropene;phenylboronic acid is C1=CC1.OB(O)c1ccccc1.
What is the InChIKey of cyclopropene;phenylboronic acid?
The InChIKey is OKZILKUTUVWOQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BO2.C3H4/c8-7(9)6-4-2-1-3-5-6;1-2-3-1/h1-5,8-9H;1-2H,3H2.
What are the key properties of cyclopropene;phenylboronic acid?
cyclopropene;phenylboronic acid has a molecular weight of 162.00 g/mol, XLogP of 0.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropene;phenylboronic acid is sourced from PubChem (CID 175112144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).