C28H41F3N2O4S — CID 175113645
N-[2-(2-aminoethoxy)ethyl]-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 175113645) has the molecular formula C28H41F3N2O4S and a molecular weight of 558.71 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175113645 |
| Molecular Formula | C28H41F3N2O4S |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSc1ccccc1C(=O)NCCOCCN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H40N2O2S.C2HF3O2/c1-21(2)9-7-10-22(3)11-8-12-23(4)15-20-31-25-14-6-5-13-24(25)26(29)28-17-19-30-18-16-27;3-2(4,5)1(6)7/h5-6,9,11,13-15H,7-8,10,12,16-20,27H2,1-4H3,(H,28,29);(H,6,7) |
| InChIKey | PVGNZOHNZHHGQD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|