About (E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium
(E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium (PubChem CID 175113731) has the molecular formula C10H15O2P
and a molecular weight of 198.20 g/mol. Its IUPAC name is (E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium.
Molecular Properties
| Compound Name | (E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium |
| PubChem CID | 175113731 |
| Molecular Formula | C10H15O2P |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | (E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium |
| SMILES | CC(C)CO/[P+]([O-])=C1/C=CC=CC1 |
| InChI | InChI=1S/C10H15O2P/c1-9(2)8-12-13(11)10-6-4-3-5-7-10/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | XRWXCNOBOSQRBZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium?
The IUPAC name of (E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium (CID 175113731) is (E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium.
What is the SMILES notation for (E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium?
The canonical SMILES for (E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium is CC(C)CO/[P+]([O-])=C1/C=CC=CC1.
What is the InChIKey of (E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium?
The InChIKey is XRWXCNOBOSQRBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15O2P/c1-9(2)8-12-13(11)10-6-4-3-5-7-10/h3-6,9H,7-8H2,1-2H3.
What are the key properties of (E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium?
(E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium has a molecular weight of 198.20 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-cyclohexa-2,4-dien-1-ylidene-(2-methylpropoxy)-oxidophosphanium is sourced from PubChem (CID 175113731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).