acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol

C14H22O4 — CID 175113858

IUPACacetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol
SMILESCC(=O)O.CCOc1ccc(C(C)(C)CO)cc1
InChIInChI=1S/C12H18O2.C2H4O2/c1-4-14-11-7-5-10(6-8-11)12(2,3)9-13;1-2(3)4/h5-8,13H,4,9H2,1-3H3;1H3,(H,3,4)
InChIKeyNJZXNAVBXQWQIX-UHFFFAOYSA-N
MW254.33 g/mol
LogP2.45
Rot. Bonds4

About acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol

acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol (PubChem CID 175113858) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol.

Molecular Properties

Compound Nameacetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol
PubChem CID175113858
Molecular FormulaC14H22O4
Molecular Weight254.33 g/mol
Exact Mass254.15
IUPAC Nameacetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol
SMILESCC(=O)O.CCOc1ccc(C(C)(C)CO)cc1
InChIInChI=1S/C12H18O2.C2H4O2/c1-4-14-11-7-5-10(6-8-11)12(2,3)9-13;1-2(3)4/h5-8,13H,4,9H2,1-3H3;1H3,(H,3,4)
InChIKeyNJZXNAVBXQWQIX-UHFFFAOYSA-N
XLogP2.45
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.33
LogP ≤ 52.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol?
The IUPAC name of acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol (CID 175113858) is acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol.
What is the SMILES notation for acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol?
The canonical SMILES for acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol is CC(=O)O.CCOc1ccc(C(C)(C)CO)cc1.
What is the InChIKey of acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol?
The InChIKey is NJZXNAVBXQWQIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2.C2H4O2/c1-4-14-11-7-5-10(6-8-11)12(2,3)9-13;1-2(3)4/h5-8,13H,4,9H2,1-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol?
acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol has a molecular weight of 254.33 g/mol, XLogP of 2.45, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-(4-ethoxyphenyl)-2-methylpropan-1-ol is sourced from PubChem (CID 175113858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).