C15H12F16O3 — CID 175114113
1-hydroxypropyl 4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-methylundec-2-enoate (PubChem CID 175114113) has the molecular formula C15H12F16O3 and a molecular weight of 544.23 g/mol. Its IUPAC name is 1-hydroxypropyl 4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-methylundec-2-enoate.
| Compound Name | 1-hydroxypropyl 4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-methylundec-2-enoate |
|---|---|
| PubChem CID | 175114113 |
| Molecular Formula | C15H12F16O3 |
| Molecular Weight | 544.23 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | 1-hydroxypropyl 4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-methylundec-2-enoate |
| SMILES | CCC(O)OC(=O)C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C15H12F16O3/c1-3-6(32)34-7(33)4-5-9(17,18)11(21,22)13(25,26)14(27,28)12(23,24)10(19,20)8(2,16)15(29,30)31/h4-6,32H,3H2,1-2H3 |
| InChIKey | LYCXIVUZIMVUCI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.23 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|