About 5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine
5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine (PubChem CID 175114467) has the molecular formula C9H14ClN5
and a molecular weight of 227.70 g/mol. Its IUPAC name is 5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine |
| PubChem CID | 175114467 |
| Molecular Formula | C9H14ClN5 |
| Molecular Weight | 227.70 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine |
| SMILES | CNc1nc(NC2CCNC2)ncc1Cl |
| InChI | InChI=1S/C9H14ClN5/c1-11-8-7(10)5-13-9(15-8)14-6-2-3-12-4-6/h5-6,12H,2-4H2,1H3,(H2,11,13,14,15) |
| InChIKey | WOZOOXZNINLAOK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.70 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine?
The IUPAC name of 5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine (CID 175114467) is 5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine?
The canonical SMILES for 5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine is CNc1nc(NC2CCNC2)ncc1Cl.
What is the InChIKey of 5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine?
The InChIKey is WOZOOXZNINLAOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClN5/c1-11-8-7(10)5-13-9(15-8)14-6-2-3-12-4-6/h5-6,12H,2-4H2,1H3,(H2,11,13,14,15).
What are the key properties of 5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine?
5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine has a molecular weight of 227.70 g/mol, XLogP of 0.95, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-N-methyl-2-N-pyrrolidin-3-ylpyrimidine-2,4-diamine is sourced from PubChem (CID 175114467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).