About 5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride
5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride (PubChem CID 175114731) has the molecular formula C7H11ClN4
and a molecular weight of 186.65 g/mol. Its IUPAC name is 5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride |
| PubChem CID | 175114731 |
| Molecular Formula | C7H11ClN4 |
| Molecular Weight | 186.65 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride |
| SMILES | Cl.[H]/N=C/c1cnc(N(C)C)nc1 |
| InChI | InChI=1S/C7H10N4.ClH/c1-11(2)7-9-4-6(3-8)5-10-7;/h3-5,8H,1-2H3;1H/b8-3+; |
| InChIKey | SGGAEDYABYOUMW-DCDCITSCSA-N |
| XLogP | 0.96 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.65 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride?
The IUPAC name of 5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride (CID 175114731) is 5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride.
What is the SMILES notation for 5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride?
The canonical SMILES for 5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride is Cl.[H]/N=C/c1cnc(N(C)C)nc1.
What is the InChIKey of 5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride?
The InChIKey is SGGAEDYABYOUMW-DCDCITSCSA-N. The full InChI is InChI=1S/C7H10N4.ClH/c1-11(2)7-9-4-6(3-8)5-10-7;/h3-5,8H,1-2H3;1H/b8-3+;.
What are the key properties of 5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride?
5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride has a molecular weight of 186.65 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methanimidoyl-N,N-dimethylpyrimidin-2-amine;hydrochloride is sourced from PubChem (CID 175114731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).