About 8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium
8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium (PubChem CID 175114966) has the molecular formula C31H40O3P+
and a molecular weight of 491.63 g/mol. Its IUPAC name is 8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium.
Molecular Properties
| Compound Name | 8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium |
| PubChem CID | 175114966 |
| Molecular Formula | C31H40O3P+ |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium |
| SMILES | CC(CCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)OC1COCCO1 |
| InChI | InChI=1S/C31H40O3P/c1-27(34-31-26-32-23-24-33-31)16-8-3-2-4-15-25-35(28-17-9-5-10-18-28,29-19-11-6-12-20-29)30-21-13-7-14-22-30/h5-7,9-14,17-22,27,31H,2-4,8,15-16,23-26H2,1H3/q+1 |
| InChIKey | NMYBJLINIPKHDI-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium?
The IUPAC name of 8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium (CID 175114966) is 8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium.
What is the SMILES notation for 8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium?
The canonical SMILES for 8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium is CC(CCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)OC1COCCO1.
What is the InChIKey of 8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium?
The InChIKey is NMYBJLINIPKHDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H40O3P/c1-27(34-31-26-32-23-24-33-31)16-8-3-2-4-15-25-35(28-17-9-5-10-18-28,29-19-11-6-12-20-29)30-21-13-7-14-22-30/h5-7,9-14,17-22,27,31H,2-4,8,15-16,23-26H2,1H3/q+1.
What are the key properties of 8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium?
8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium has a molecular weight of 491.63 g/mol, XLogP of 6.10, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1,4-dioxan-2-yloxy)nonyl-triphenylphosphanium is sourced from PubChem (CID 175114966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).