C29H28ClN6O5S- — CID 175115210
2-[[(3S)-1-carboxypiperidin-3-yl]amino]-4-[2-[4-(2-chloro-N-sulfinatoanilino)-2,3-dimethylphenoxy]-3-pyridinyl]pyrimidine (PubChem CID 175115210) has the molecular formula C29H28ClN6O5S- and a molecular weight of 608.10 g/mol. Its IUPAC name is 2-[[(3S)-1-carboxypiperidin-3-yl]amino]-4-[2-[4-(2-chloro-N-sulfinatoanilino)-2,3-dimethylphenoxy]-3-pyridinyl]pyrimidine.
| Compound Name | 2-[[(3S)-1-carboxypiperidin-3-yl]amino]-4-[2-[4-(2-chloro-N-sulfinatoanilino)-2,3-dimethylphenoxy]-3-pyridinyl]pyrimidine |
|---|---|
| PubChem CID | 175115210 |
| Molecular Formula | C29H28ClN6O5S- |
| Molecular Weight | 608.10 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | 2-[[(3S)-1-carboxypiperidin-3-yl]amino]-4-[2-[4-(2-chloro-N-sulfinatoanilino)-2,3-dimethylphenoxy]-3-pyridinyl]pyrimidine |
| SMILES | Cc1c(Oc2ncccc2-c2ccnc(N[C@H]3CCCN(C(=O)O)C3)n2)ccc(N(c2ccccc2Cl)S(=O)[O-])c1C |
| InChI | InChI=1S/C29H29ClN6O5S/c1-18-19(2)26(12-11-24(18)36(42(39)40)25-10-4-3-9-22(25)30)41-27-21(8-5-14-31-27)23-13-15-32-28(34-23)33-20-7-6-16-35(17-20)29(37)38/h3-5,8-15,20H,6-7,16-17H2,1-2H3,(H,37,38)(H,39,40)(H,32,33,34)/p-1/t20-/m0/s1 |
| InChIKey | KFCDHBXXLOPQQB-FQEVSTJZSA-M |
| XLogP | 6.09 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.10 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|