C13H8F8 — CID 175115242
8-(cyclopenten-1-yl)-2,3,4,5,6,7,7,8-octafluorobicyclo[4.2.0]octa-1,3-diene (PubChem CID 175115242) has the molecular formula C13H8F8 and a molecular weight of 316.19 g/mol. Its IUPAC name is 8-(cyclopenten-1-yl)-2,3,4,5,6,7,7,8-octafluorobicyclo[4.2.0]octa-1,3-diene.
| Compound Name | 8-(cyclopenten-1-yl)-2,3,4,5,6,7,7,8-octafluorobicyclo[4.2.0]octa-1,3-diene |
|---|---|
| PubChem CID | 175115242 |
| Molecular Formula | C13H8F8 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 8-(cyclopenten-1-yl)-2,3,4,5,6,7,7,8-octafluorobicyclo[4.2.0]octa-1,3-diene |
| SMILES | FC1=C(F)C(F)C2(F)C(=C1F)C(F)(C1=CCCC1)C2(F)F |
| InChI | InChI=1S/C13H8F8/c14-6-7(15)9-11(18,5-3-1-2-4-5)13(20,21)12(9,19)10(17)8(6)16/h3,10H,1-2,4H2 |
| InChIKey | XCNGLQCDMHRKCP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|