About cobalt;2-methyl-1H-imidazol-1-ium;nitrate
cobalt;2-methyl-1H-imidazol-1-ium;nitrate (PubChem CID 175115451) has the molecular formula C4H7CoN3O3
and a molecular weight of 204.05 g/mol. Its IUPAC name is cobalt;2-methyl-1H-imidazol-1-ium;nitrate.
Molecular Properties
| Compound Name | cobalt;2-methyl-1H-imidazol-1-ium;nitrate |
| PubChem CID | 175115451 |
| Molecular Formula | C4H7CoN3O3 |
| Molecular Weight | 204.05 g/mol |
| Exact Mass | 203.98 |
| IUPAC Name | cobalt;2-methyl-1H-imidazol-1-ium;nitrate |
| SMILES | CC1=NC=C[NH2+]1.O=[N+]([O-])[O-].[Co] |
| InChI | InChI=1S/C4H6N2.Co.NO3/c1-4-5-2-3-6-4;;2-1(3)4/h2-3H,1H3,(H,5,6);;/q;;-1/p+1 |
| InChIKey | NIHJLPCIPLORAB-UHFFFAOYSA-O |
| XLogP | -0.79 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.05 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cobalt;2-methyl-1H-imidazol-1-ium;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;2-methyl-1H-imidazol-1-ium;nitrate?
The IUPAC name of cobalt;2-methyl-1H-imidazol-1-ium;nitrate (CID 175115451) is cobalt;2-methyl-1H-imidazol-1-ium;nitrate.
What is the SMILES notation for cobalt;2-methyl-1H-imidazol-1-ium;nitrate?
The canonical SMILES for cobalt;2-methyl-1H-imidazol-1-ium;nitrate is CC1=NC=C[NH2+]1.O=[N+]([O-])[O-].[Co].
What is the InChIKey of cobalt;2-methyl-1H-imidazol-1-ium;nitrate?
The InChIKey is NIHJLPCIPLORAB-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H6N2.Co.NO3/c1-4-5-2-3-6-4;;2-1(3)4/h2-3H,1H3,(H,5,6);;/q;;-1/p+1.
What are the key properties of cobalt;2-methyl-1H-imidazol-1-ium;nitrate?
cobalt;2-methyl-1H-imidazol-1-ium;nitrate has a molecular weight of 204.05 g/mol, XLogP of -0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;2-methyl-1H-imidazol-1-ium;nitrate is sourced from PubChem (CID 175115451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).