About 1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium
1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium (PubChem CID 175116359) has the molecular formula C11H16NO2Pd-
and a molecular weight of 300.67 g/mol. Its IUPAC name is 1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium.
Molecular Properties
| Compound Name | 1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium |
| PubChem CID | 175116359 |
| Molecular Formula | C11H16NO2Pd- |
| Molecular Weight | 300.67 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium |
| SMILES | COc1c[c-]c(CN(C)C)c(OC)c1.[Pd] |
| InChI | InChI=1S/C11H16NO2.Pd/c1-12(2)8-9-5-6-10(13-3)7-11(9)14-4;/h6-7H,8H2,1-4H3;/q-1; |
| InChIKey | ZOENCQZSKZFKNK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.67 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium?
The IUPAC name of 1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium (CID 175116359) is 1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium.
What is the SMILES notation for 1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium?
The canonical SMILES for 1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium is COc1c[c-]c(CN(C)C)c(OC)c1.[Pd].
What is the InChIKey of 1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium?
The InChIKey is ZOENCQZSKZFKNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16NO2.Pd/c1-12(2)8-9-5-6-10(13-3)7-11(9)14-4;/h6-7H,8H2,1-4H3;/q-1;.
What are the key properties of 1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium?
1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium has a molecular weight of 300.67 g/mol, XLogP of 1.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine;palladium is sourced from PubChem (CID 175116359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).