C21H27BF2N2O5S — CID 175116398
2,4-difluoro-N-[3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-N-propylbenzenesulfonamide (PubChem CID 175116398) has the molecular formula C21H27BF2N2O5S and a molecular weight of 468.33 g/mol. Its IUPAC name is 2,4-difluoro-N-[3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-N-propylbenzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 175116398 |
| Molecular Formula | C21H27BF2N2O5S |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 2,4-difluoro-N-[3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-N-propylbenzenesulfonamide |
| SMILES | CCCN(c1nc(B2OC(C)(C)C(C)(C)O2)ccc1OC)S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H27BF2N2O5S/c1-7-12-26(32(27,28)17-10-8-14(23)13-15(17)24)19-16(29-6)9-11-18(25-19)22-30-20(2,3)21(4,5)31-22/h8-11,13H,7,12H2,1-6H3 |
| InChIKey | XWILFNIEQVUPII-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|