About phenazine-1-carboxamide;1,3,4-thiadiazole
phenazine-1-carboxamide;1,3,4-thiadiazole (PubChem CID 175116652) has the molecular formula C15H11N5OS
and a molecular weight of 309.35 g/mol. Its IUPAC name is phenazine-1-carboxamide;1,3,4-thiadiazole.
Molecular Properties
| Compound Name | phenazine-1-carboxamide;1,3,4-thiadiazole |
| PubChem CID | 175116652 |
| Molecular Formula | C15H11N5OS |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | phenazine-1-carboxamide;1,3,4-thiadiazole |
| SMILES | NC(=O)c1cccc2nc3ccccc3nc12.c1nncs1 |
| InChI | InChI=1S/C13H9N3O.C2H2N2S/c14-13(17)8-4-3-7-11-12(8)16-10-6-2-1-5-9(10)15-11;1-3-4-2-5-1/h1-7H,(H2,14,17);1-2H |
| InChIKey | UCOYLIFKKUYOOB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze phenazine-1-carboxamide;1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenazine-1-carboxamide;1,3,4-thiadiazole?
The IUPAC name of phenazine-1-carboxamide;1,3,4-thiadiazole (CID 175116652) is phenazine-1-carboxamide;1,3,4-thiadiazole.
What is the SMILES notation for phenazine-1-carboxamide;1,3,4-thiadiazole?
The canonical SMILES for phenazine-1-carboxamide;1,3,4-thiadiazole is NC(=O)c1cccc2nc3ccccc3nc12.c1nncs1.
What is the InChIKey of phenazine-1-carboxamide;1,3,4-thiadiazole?
The InChIKey is UCOYLIFKKUYOOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O.C2H2N2S/c14-13(17)8-4-3-7-11-12(8)16-10-6-2-1-5-9(10)15-11;1-3-4-2-5-1/h1-7H,(H2,14,17);1-2H.
What are the key properties of phenazine-1-carboxamide;1,3,4-thiadiazole?
phenazine-1-carboxamide;1,3,4-thiadiazole has a molecular weight of 309.35 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phenazine-1-carboxamide;1,3,4-thiadiazole is sourced from PubChem (CID 175116652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).