sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine

C6H16N2O2S — CID 175116714

IUPACsulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine
SMILESCN(C)CCN(C)C.O=S=O
InChIInChI=1S/C6H16N2.O2S/c1-7(2)5-6-8(3)4;1-3-2/h5-6H2,1-4H3;
InChIKeyYGMSTMDKVDBERH-UHFFFAOYSA-N
MW180.27 g/mol
LogP-0.56
Rot. Bonds3

About sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine

sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine (PubChem CID 175116714) has the molecular formula C6H16N2O2S and a molecular weight of 180.27 g/mol. Its IUPAC name is sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine.

Molecular Properties

Compound Namesulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine
PubChem CID175116714
Molecular FormulaC6H16N2O2S
Molecular Weight180.27 g/mol
Exact Mass180.09
IUPAC Namesulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine
SMILESCN(C)CCN(C)C.O=S=O
InChIInChI=1S/C6H16N2.O2S/c1-7(2)5-6-8(3)4;1-3-2/h5-6H2,1-4H3;
InChIKeyYGMSTMDKVDBERH-UHFFFAOYSA-N
XLogP-0.56
TPSA40.62 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.27
LogP ≤ 5-0.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine?
The IUPAC name of sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine (CID 175116714) is sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine.
What is the SMILES notation for sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine?
The canonical SMILES for sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine is CN(C)CCN(C)C.O=S=O.
What is the InChIKey of sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine?
The InChIKey is YGMSTMDKVDBERH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2.O2S/c1-7(2)5-6-8(3)4;1-3-2/h5-6H2,1-4H3;.
What are the key properties of sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine?
sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine has a molecular weight of 180.27 g/mol, XLogP of -0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine is sourced from PubChem (CID 175116714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).