About sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine
sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine (PubChem CID 175116714) has the molecular formula C6H16N2O2S
and a molecular weight of 180.27 g/mol. Its IUPAC name is sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine.
Analyze sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine?
The IUPAC name of sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine (CID 175116714) is sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine.
What is the SMILES notation for sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine?
The canonical SMILES for sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine is CN(C)CCN(C)C.O=S=O.
What is the InChIKey of sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine?
The InChIKey is YGMSTMDKVDBERH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2.O2S/c1-7(2)5-6-8(3)4;1-3-2/h5-6H2,1-4H3;.
What are the key properties of sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine?
sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine has a molecular weight of 180.27 g/mol, XLogP of -0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfur dioxide;N,N,N',N'-tetramethylethane-1,2-diamine is sourced from PubChem (CID 175116714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).