About 2-fluoro-1-benzazocine
2-fluoro-1-benzazocine (PubChem CID 175116888) has the molecular formula C11H8FN
and a molecular weight of 173.19 g/mol. Its IUPAC name is 2-fluoro-1-benzazocine.
Molecular Properties
| Compound Name | 2-fluoro-1-benzazocine |
| PubChem CID | 175116888 |
| Molecular Formula | C11H8FN |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 2-fluoro-1-benzazocine |
| SMILES | FC1=CC=CC=c2ccccc2=N1 |
| InChI | InChI=1S/C11H8FN/c12-11-8-4-2-6-9-5-1-3-7-10(9)13-11/h1-8H |
| InChIKey | ZJIVRLHCPAGHJE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-1-benzazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1-benzazocine?
The IUPAC name of 2-fluoro-1-benzazocine (CID 175116888) is 2-fluoro-1-benzazocine.
What is the SMILES notation for 2-fluoro-1-benzazocine?
The canonical SMILES for 2-fluoro-1-benzazocine is FC1=CC=CC=c2ccccc2=N1.
What is the InChIKey of 2-fluoro-1-benzazocine?
The InChIKey is ZJIVRLHCPAGHJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FN/c12-11-8-4-2-6-9-5-1-3-7-10(9)13-11/h1-8H.
What are the key properties of 2-fluoro-1-benzazocine?
2-fluoro-1-benzazocine has a molecular weight of 173.19 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1-benzazocine is sourced from PubChem (CID 175116888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).